CAS 20778-16-9

4-hydroxy-N-(pyrimidin-2-yl)benzenesulfonamidato

Description:

4-Hydroxy-N-(pyrimidin-2-yl)benzenesulfonamidato, with the CAS number 20778-16-9, is a chemical compound characterized by its sulfonamide structure, which includes a sulfonyl group attached to an amine. This compound features a pyrimidine ring, a six-membered aromatic benzene ring, and a hydroxyl group, contributing to its potential biological activity. The presence of the hydroxyl group enhances its solubility and reactivity, while the pyrimidine moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. The sulfonamide functional group is known for its antibacterial properties, and compounds like this may exhibit various biological activities, including enzyme inhibition. Its molecular structure suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts.

Formula: C₁₀H₉N₃O₃S

InChI: InChI=1/C10H9N3O3S/c14-8-2-4-9(5-3-8)17(15,16)13-10-11-6-1-7-12-10/h1-7,14H,(H,11,12,13)

SMILES: c1cnc(nc1)NS(=O)(=O)c1ccc(cc1)O

4-Hydroxy Sulfadiazine

Controlled Product

CAS: 20778-16-9

Formula: C₁₀H₉N₃O₃S

Color and Shape: Neat

Molecular weight: 251.262

Ref: TR-H977680

Benzenesulfonamide

CAS: 20778-16-9

Benzenesulfonamide is a drug product that is used as an analytical standard. It is a synthetic drug that has been shown to be metabolized by the liver, forming metabolites such as hydroxybenzenesulfonamide and sulfamethoxazole. Benzenesulfonamide is not under any pharmacopoeia guidelines or regulations. The CAS number for this drug product is 20778-16-9.

Formula: C₁₀H₉N₃O₃S

Purity: Min. 95%

Molecular weight: 251.26 g/mol

Ref: 3D-VAA77816