CAS 207798-97-8

sodium 4-(pyridin-4-yl)benzoate

Description:

Sodium 4-(pyridin-4-yl)benzoate, with the CAS number 207798-97-8, is a chemical compound that serves as a sodium salt of 4-(pyridin-4-yl)benzoic acid. It typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium ion, which enhances its solubility compared to its acid form. The compound features a pyridine ring, which contributes to its aromatic character and potential biological activity. It is often used in various applications, including as a reagent in organic synthesis and in studies related to coordination chemistry. The presence of both the benzoate and pyridine functional groups may impart unique properties, such as the ability to form complexes with metal ions. Additionally, sodium 4-(pyridin-4-yl)benzoate may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical and agricultural research. As with any chemical substance, proper handling and safety measures should be observed to mitigate any potential hazards.

Formula: C₁₂H₈NNaO₂

InChI: InChI=1/C12H9NO2.Na/c14-12(15)11-3-1-9(2-4-11)10-5-7-13-8-6-10;/h1-8H,(H,14,15);/q;+1/p-1

SMILES: c1cc(ccc1c1ccncc1)C(=O)O.[Na]

Sodium 4-pyridin-4-ylbenzoate

CAS: 207798-97-8

Sodium 4-pyridin-4-ylbenzoate

Purity: ≥95%

Molecular weight: 221.19g/mol

Ref: 54-OR3582