CAS 2078-01-5
:3-nitro-5-(trifluoromethyl)benzene-1,2-diamine
Description:
3-Nitro-5-(trifluoromethyl)benzene-1,2-diamine, with the CAS number 2078-01-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a nitro group and a trifluoromethyl group, as well as two amino groups located at the 1 and 2 positions of the ring. This compound is typically a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro and trifluoromethyl groups contributes to its chemical reactivity and polarity, influencing its solubility in different solvents. Additionally, the amino groups can participate in hydrogen bonding, enhancing its interactions with other molecules. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, 3-nitro-5-(trifluoromethyl)benzene-1,2-diamine is a compound of interest in synthetic organic chemistry, particularly for its unique functional groups and their implications in chemical reactivity.
Formula:C7H6F3N3O2
InChI:InChI=1/C7H6F3N3O2/c8-7(9,10)3-1-4(11)6(12)5(2-3)13(14)15/h1-2H,11-12H2
SMILES:c1c(cc(c(c1N)N)N(=O)=O)C(F)(F)F
Synonyms:- 1,2-Benzenediamine, 3-nitro-5-(trifluoromethyl)-
- 3-Nitro-5-(trifluoromethyl)-1,2-benzenediamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Nitro-5-(trifluoromethyl)benzene-1,2-diamine
CAS:3-Nitro-5-(trifluoromethyl)benzene-1,2-diaminePurity:95%Molecular weight:221.14g/mol3-Nitro-5-(trifluoromethyl)benzene-1,2-diamine
CAS:3-Nitro-5-(trifluoromethyl)benzene-1,2-diamine is a chemical compound that can be used as a reaction component or reagent in research. It is a useful scaffold and building block for complex compounds. 3-Nitro-5-(trifluoromethyl)benzene-1,2-diamine has CAS No. 2078-01-5 and is classified as a speciality chemical. This chemical is versatile because it has many uses in both organic chemistry and biology, including use as an intermediate or building block for more complex compounds.Formula:C7H6F3N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:221.14 g/mol


