CAS 20780-72-7
:4-Bromoisatin
Description:
4-Bromoisatin is an organic compound that belongs to the class of isatin derivatives, characterized by the presence of a bromine atom at the 4-position of the isatin structure. Its molecular formula is C8H6BrN1O2, indicating the presence of a bromine atom, a carbonyl group, and an amine functional group. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. 4-Bromoisatin can participate in various chemical reactions, such as nucleophilic substitutions and cyclization, making it a valuable intermediate in organic synthesis. Its solubility varies depending on the solvent, and it is often used in research settings to explore its reactivity and biological effects. The compound's unique structure allows for interactions with biological targets, which is of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.
Formula:C8H4BrNO2
InChI:InChI=1/C8H4BrNO2/c9-4-2-1-3-5-6(4)7(11)8(12)10-5/h1-3H,(H,10,11,12)
SMILES:c1cc(c2c(c1)NC(=O)C2=O)Br
Synonyms:- 4-Bromo-1H-indole-2,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:226.031H-Indole-2,3-dione, 4-bromo-
CAS:Formula:C8H4BrNO2Purity:98%Color and Shape:SolidMolecular weight:226.02694-Bromoisatin
CAS:4-BromoisatinFormula:C8H4BrNO2Purity:98%Color and Shape: yellow to orange solidMolecular weight:226.03g/mol4-Bromo-1H-indole-2,3-dione
CAS:Formula:C8H4BrNO2Purity:97%Color and Shape:SolidMolecular weight:226.0294-Bromoisatin
CAS:4-Bromoisatin is a synthetic compound that reversibly inhibits the activity of telomerase and has been shown to be effective against a broad range of bacterial species. It binds to the catalytic site on telomerase and prevents the synthesis of ribonucleotides, which are necessary for DNA replication. 4-Bromoisatin is synthesized by humans, but can also be found in plants such as coffee beans and black tea leaves. The antibacterial properties of 4-bromoisatin may be due to its ability to inhibit the biosynthesis of purine, an essential component in bacterial DNA synthesis.Formula:C8H4BrNO2Purity:Min. 95%Color and Shape:Orange PowderMolecular weight:226.03 g/mol





