CAS 20780-74-9: 7-Bromoisatin
Description:7-Bromoisatin is a chemical compound that belongs to the class of isatin derivatives, characterized by the presence of a bromine atom at the 7-position of the isatin structure. Its molecular formula is C8H5BrN2O2, indicating the presence of a bromine atom, carbon, hydrogen, nitrogen, and oxygen. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the bromine substituent can influence its reactivity and solubility, making it of interest in medicinal chemistry and organic synthesis. 7-Bromoisatin can undergo various chemical reactions, such as nucleophilic substitutions and cyclizations, which can be utilized to synthesize more complex molecules. Additionally, its structure allows for interactions with biological targets, making it a subject of research in drug development. As with many halogenated compounds, safety precautions should be taken when handling 7-Bromoisatin due to its potential toxicity and environmental impact.
Formula:C8H4BrNO2
InChI:InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12)
InChI key:InChIKey=OCVKSIWBTJCXPV-UHFFFAOYSA-N
SMILES:O=C1NC=2C(Br)=CC=CC2C1=O
- Synonyms:
- 1H-Indole-2,3-dione, 7-bromo-
- 7-Bromo-2,3-dioxoindoline
- 7-Bromoindole-1H-2,3-dione
- 7-Bromoindole-2,3-dione
- 7-Bromoindoline-2,3-Dione
- 7-bromo-1H-indole-2,3-dione
- Indole-2,3-dione, 7-bromo-
- Isatin, 7-bromo-
- 7-Bromoisatin
