CAS 20780-74-9
:7-Bromoisatin
Description:
7-Bromoisatin is a chemical compound that belongs to the class of isatin derivatives, characterized by the presence of a bromine atom at the 7-position of the isatin structure. Its molecular formula is C8H5BrN2O2, indicating the presence of a bromine atom, carbon, hydrogen, nitrogen, and oxygen. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the bromine substituent can influence its reactivity and solubility, making it of interest in medicinal chemistry and organic synthesis. 7-Bromoisatin can undergo various chemical reactions, such as nucleophilic substitutions and cyclizations, which can be utilized to synthesize more complex molecules. Additionally, its structure allows for interactions with biological targets, making it a subject of research in drug development. As with many halogenated compounds, safety precautions should be taken when handling 7-Bromoisatin due to its potential toxicity and environmental impact.
Formula:C8H4BrNO2
InChI:InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12)
InChI key:InChIKey=OCVKSIWBTJCXPV-UHFFFAOYSA-N
SMILES:O=C1C=2C(=C(Br)C=CC2)NC1=O
Synonyms:- 1H-Indole-2,3-dione, 7-bromo-
- 7-Bromo-2,3-dioxoindoline
- 7-Bromoindole-1H-2,3-dione
- 7-Bromoindole-2,3-dione
- 7-Bromoindoline-2,3-Dione
- 7-bromo-1H-indole-2,3-dione
- Indole-2,3-dione, 7-bromo-
- Isatin, 7-bromo-
- 7-Bromoisatin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:>97.0%(GC)Color and Shape:Orange to Amber to Dark red powder to crystalMolecular weight:226.037-Bromoisatin, 97%
CAS:7-bromoisatin was treated with excess PhMgBr to afford tertiary alcohol 9 in 96 % yield. Isatin oxime triflates undergo a facile fragmentation which is promoted by DBU, to form anthranilonitriles after hydrolytic work-up.This Thermo Scientific Chemicals brand product was originally part of the Alfa
Formula:C8H4BrNO2Purity:97%Color and Shape:Red, Crystals or powder or crystalline powderMolecular weight:226.031H-Indole-2,3-dione, 7-bromo-
CAS:Formula:C8H4BrNO2Purity:95%Color and Shape:SolidMolecular weight:226.02697-Bromoisatin
CAS:7-BromoisatinFormula:C8H4BrNO2Purity:95%Color and Shape: red solidMolecular weight:226.03g/mol7-Bromo-2,3-dioxoindoline
CAS:7-Bromo-2,3-dioxoindoline is a synthetic compound with a vibrational frequency of 249.2 cm−1. It is an inhibitor of the enzyme synthetase and has been shown to have an inhibitory effect on cancer cell viability in vitro. 7-Bromo-2,3-dioxoindoline inhibits the production of cancerous cells by interfering with their ability to synthesize DNA, which is necessary for cell division. This inhibition may be due to its ability to form intermolecular hydrogen bonding interactions with the amine group on the enzyme synthetase. 7-Bromo-2,3-dioxoindoline has also been shown to block the synthesis of 5-chloroisatin, one of its reaction products. The bioassay was carried out by measuring the amount of granulosa cells that were able to produce estrogen after treatment with this compound.Formula:C8H4BrNO2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:226.03 g/mol





