CAS 207844-01-7
:Mitiglinide Calcium dihydrate
Description:
Mitiglinide calcium dihydrate is an oral hypoglycemic agent primarily used in the management of type 2 diabetes mellitus. It functions as a rapid-acting insulin secretagogue, stimulating insulin release from the pancreas in response to meals, thereby helping to control postprandial blood glucose levels. The chemical structure of mitiglinide features a unique benzoic acid derivative, which contributes to its pharmacological activity. As a calcium salt, the dihydrate form indicates the presence of two water molecules associated with each calcium ion, which can influence its solubility and stability. Mitiglinide is characterized by its relatively short half-life, necessitating multiple daily doses to maintain glycemic control. It is generally well-tolerated, though potential side effects may include hypoglycemia and gastrointestinal disturbances. The compound is typically administered in conjunction with dietary modifications and exercise to optimize blood glucose management. As with any medication, it is essential for patients to consult healthcare professionals for personalized treatment plans and to monitor for any adverse reactions.
Formula:C19H27CaNO4
InChI:InChI=1/C19H25NO3.Ca.H2O/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14;;/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23);;1H2/q;+2;/t15-,16+,17-;;/m0../s1
Synonyms:- (S)-2-Benzyl-4-oxo-4-(cis-perhydroisoindol-2-yl)butyric acid calcium salt dihydrate
- (aS,3aR,7aS)-Octahydro-gamma-oxo-alpha-(phenylmethyl)-2H-isoindole-2-butanoic acid calcium salt dihydrate
- Calcium Mitiglinide dihydrate
- 2H-isoindole-2-butanoic acid, octahydro-γ-oxo-α-(phenylmethyl)-, (alphaS,3aR,7aS)-, calcium salt, monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2H-Isoindole-2-butanoic acid, octahydro-γ-oxo-α-(phenylmethyl)-, calcium salt, hydrate (2:1:2), (αS,3aR,7aS)-
CAS:Formula:C19H27CaNO4Purity:98%Color and Shape:SolidMolecular weight:373.5000Mitiglinide calcium hydrate
CAS:<p>Mitiglinide calcium hydrate</p>Purity:≥98%Molecular weight:704.91g/molMitiglinide Calcium Dihydrate
CAS:<p>Mitiglinide Calcium Dihydrate</p>Purity:98%Molecular weight:704.91g/molMitiglinide calcium hydrate
CAS:<p>Mitiglinide calcium hydrate (S-21403 calcium hydrate) is a drug for the treatment of type 2 diabetes.</p>Formula:C38H52CaN2O8Purity:98.97% - 99.96%Color and Shape:White SolidMolecular weight:704.91KAD-1229 Calcium Hydrate
CAS:Controlled ProductFormula:C19H24NO3·Ca·2H2OColor and Shape:NeatMolecular weight:704.91






