CAS 207857-15-6
:tert-butyl {(tert-butoxycarbonyl)[(trifluoromethyl)sulfonyl]carbamimidoyl}carbamate (non-preferred name)
Description:
Tert-butyl {(tert-butoxycarbonyl)[(trifluoromethyl)sulfonyl]carbamimidoyl}carbamate, identified by its CAS number 207857-15-6, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a carbamate moiety, and a trifluoromethylsulfonyl group. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a protecting group for amines and its potential reactivity in various chemical transformations. The presence of the trifluoromethyl group enhances its lipophilicity and can influence the compound's biological activity. Additionally, the tert-butoxycarbonyl (Boc) group provides stability and protection to the amine functionality during synthetic processes. The compound's properties, such as solubility and reactivity, are influenced by its functional groups, making it a valuable intermediate in synthetic organic chemistry. Safety data and handling precautions should be observed, as with many chemical substances, to ensure safe laboratory practices.
Formula:C12H20F3N3O6S
InChI:InChI=1/C12H20F3N3O6S/c1-10(2,3)23-8(19)16-7(17-9(20)24-11(4,5)6)18-25(21,22)12(13,14)15/h1-6H3,(H2,16,17,18,19,20)
SMILES:CC(C)(C)OC(=O)N=C(N=C(O)OC(C)(C)C)NS(=O)(=O)C(F)(F)F
Synonyms:- 1,3-Di-Boc-2-(Trifluoromethylsulfonyl)Guanidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3-DI-BOC-2-(TRIFLUOROMETHYLSULFONYL)GUANIDINE
CAS:Formula:C12H20F3N3O6SPurity:97%Color and Shape:SolidMolecular weight:391.36391,3-Bis(tert-butoxycarbonyl)-2-(trifluoromethanesulfonyl)guanidine
CAS:Formula:C12H20F3N3O6SPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:391.362-[(Trifluoromethyl)sulphonyl]guanidine, 1,3-Bis-BOC protected
CAS:2-[(Trifluoromethyl)sulphonyl]guanidine, 1,3-Bis-BOC protectedFormula:C12H20F3N3O6SPurity:97%Color and Shape: white solidMolecular weight:391.36g/mol1,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine
CAS:<p>1,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine is a growth factor that has been shown to bind to histone proteins and human pathogens. It has physiological effects on prostate cancer cells and fatty acid metabolism. 1,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine is also antibacterial agent that has potent activity against bacterial cell walls. This drug inhibits the enzyme Clavatadine, leading to the inhibition of protein synthesis in bacteria. The spacing of nitrogen atoms in this molecule is responsible for its potent inhibition of kinase activity. 1,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine is localized in the cellular cytoplasm and nucleus.</p>Formula:C12H20F3N3O6SPurity:Min. 95%Color and Shape:White PowderMolecular weight:391.37 g/moltert-Butyl [(tert-Butoxycarbonyl)amino]{[(trifluoromethyl)-sulfonyl]imino}methylcarbamate
CAS:Formula:C12H20F3N3O6SPurity:95%Color and Shape:SolidMolecular weight:391.361,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine (~90%)
CAS:Controlled Product<p>Applications 1,3-Di-Boc-2-(trifluoromethylsulfonyl)guanidine is a guanidinylation reagent for amines and peptides.<br>References Feichtinger, K., et al.: J. Org. Chem., 63, 8432 (1998)<br></p>Formula:C12H20F3N3O6SPurity:~90%Color and Shape:NeatMolecular weight:391.36





