
CAS 2079-78-9
:1,6-Hexanediaminium, N,N,N,N′,N′,N′-hexamethyl-, salt with (2R,3R)-2,3-dihydroxybutanedioic acid (1:2)
Description:
1,6-Hexanediaminium, N,N,N,N′,N′,N′-hexamethyl-, salt with (2R,3R)-2,3-dihydroxybutanedioic acid (1:2), commonly known as a quaternary ammonium compound, is characterized by its complex structure that includes a hexamethylated hexanediamine and a dihydroxybutanedioic acid moiety. This compound typically exhibits properties such as high solubility in polar solvents due to its ionic nature, and it may possess surfactant-like characteristics, making it useful in various applications, including as a stabilizer or emulsifier. The presence of multiple methyl groups enhances its hydrophobic character, while the dihydroxybutanedioic acid contributes to its potential for forming hydrogen bonds, influencing its reactivity and interaction with other substances. Additionally, this compound may demonstrate biological activity, which could be relevant in pharmaceutical or biochemical contexts. Its stability and compatibility with other materials make it a candidate for research in fields such as materials science and biochemistry.
Formula:C12H30N2·2C4H5O6
InChI:InChI=1S/C12H30N2.C4H6O6/c1-13(2,3)11-9-7-8-10-12-14(4,5)6;5-1(3(7)8)2(6)4(9)10/h7-12H2,1-6H3;1-2,5-6H,(H,7,8)(H,9,10)/q+2;/p-1/t;1-,2-/m.1/s1
InChI key:InChIKey=XQYVGVKPIWLENM-LREBCSMRSA-M
SMILES:[C@@H]([C@H](C(O)=O)O)(C([O-])=O)O.C([N+](C)(C)C)CCCCC[N+](C)(C)C
Synonyms:- Hexamethylenebis[trimethylammonium hydrogen tartrate]
- Ammonium, hexamethylenebis[trimethyl-, tartrate (1:2)
- 1,6-Hexanediaminium, N,N,N,N′,N′,N′-hexamethyl-, salt with (2R,3R)-2,3-dihydroxybutanedioic acid (1:2)
- 1,6-Hexanediaminium, N,N,N,N′,N′,N′-hexamethyl-, salt with [R-(R*,R*)]-2,3-dihydroxybutanedioic acid (1:2)
- Tartaric acid, ion(1-), hexamethylenebis[trimethylammonium] (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Hexamethonium tartrate
CAS:Hexamethonium tartrate, a non-absorbable, brain-impenetrable ganglionic blocker, once used for hypertension, now a research tool.Formula:C20H38N2O122Color and Shape:SolidMolecular weight:498.53

