CAS 2079-89-2: Propanenitrile, 3-amino-, (2E)-2-butenedioate (2:1)
Description:Propanenitrile, 3-amino-, (2E)-2-butenedioate (2:1), also known by its CAS number 2079-89-2, is a chemical compound characterized by its structural components, which include a propanenitrile moiety and a butenedioate group. This compound typically exhibits properties associated with both amines and nitriles, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of the amino group suggests that it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the (2E)- configuration indicates a specific geometric arrangement around the double bond in the butenedioate portion, which can affect its biological activity and stability. This compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and behavior in various environments.
Formula:C4H4O4·2C3H6N2
InChI:InChI=1S/C4H4O4.C3H6N2/c5-3(6)1-2-4(7)8;4-2-1-3-5/h1-2H,(H,5,6)(H,7,8);1-2,4H2/b2-1+;
InChI key:InChIKey=NYPGBHKJFKQTIY-TYYBGVCCSA-N
SMILES:N#CCCN.O=C(O)C=CC(=O)O
- Synonyms:
- (2E)-but-2-enedioate
- 2-Cyanoethylamine hemifumarate
- 3-Aminopionitrile Fumarate
- 3-Aminopropanenitrile hemifumarate
- 3-Aminopropionitrile fumarate (2:1)
- 3-aminopropanenitrile (2Z)-but-2-enedioate (2:1)
- B-aminopropionitrile monofumarate
- Di(2-Cyanoethylammonium) Fumarate
- Di-beta-aminopropionitrile fumarate
- Di-β-aminopropionitrile fumarate
- See more synonyms
- Einecs 218-208-7
- Fumaric acid, salt with 3-aminopropionitrile
- Propanenitrile, 3-amino-, (2E)-2-butenedioate (2:1)
- Propanenitrile, 3-amino-, (E)-2-butenedioate (2:1)
- Propionitrile, 3-amino-, fumarate (2:1)
- beta-Aminopropionitrile, fumarate
- β-Aminopropionitrile fumarate
- β-Ammoniumpropionitrile hemifumarate
