CAS 207983-28-6

Butanoic acid,3-(methylthio)-, methyl ester

Description:

Butanoic acid, 3-(methylthio)-, methyl ester, also known by its CAS number 207983-28-6, is an organic compound characterized by its ester functional group derived from butanoic acid and methanol. This compound features a butanoic acid backbone with a methylthio group at the third carbon position, which contributes to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as fatty or rancid. The presence of the methylthio group can impart specific reactivity and solubility characteristics, making it of interest in various chemical applications, including flavoring and fragrance industries. Its molecular structure allows for moderate polarity, influencing its solubility in organic solvents while being less soluble in water. Additionally, butanoic acid derivatives are known for their potential biological activity, which may include antimicrobial properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₆H₁₂O₂S

InChI: InChI=1S/C6H12O2S/c1-5(9-3)4-6(7)8-2/h5H,4H2,1-3H3

InChI key: InChIKey=HJJHJUWCICDDEL-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C(SC)C

Synonyms:

• Methyl 3-(methylthio)butanoate
• Methyl3-(Methylthio)Butanoate
• Butanoic acid, 3-(methylthio)-, methyl ester
• methyl 3-(methylsulfanyl)butanoate

methyl 3-(methylsulfanyl)butanoate

CAS: 207983-28-6

Formula: C₆H₁₂O₂S

Molecular weight: 148.2233

Ref: IN-DA002JE0

Methyl 3-(methylsulfanyl)butanoate

CAS: 207983-28-6

Versatile small molecule scaffold

Formula: C₆H₁₂O₂S

Purity: Min. 95%

Molecular weight: 148.23 g/mol

Ref: 3D-HIA98328