CAS 207986-20-7

3-fluoro-5-(trifluoromethyl)benzamide

Description:

3-Fluoro-5-(trifluoromethyl)benzamide is an aromatic compound characterized by the presence of a benzene ring substituted with a fluorine atom at the meta position and a trifluoromethyl group at the para position relative to the amide functional group. This compound features a carbonyl group (C=O) bonded to a nitrogen atom (N), which is further connected to the benzene ring, defining its amide structure. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its reactivity and biological activity. The presence of fluorine atoms generally enhances the stability and metabolic resistance of organic molecules, making them of interest in pharmaceuticals and agrochemicals. Additionally, the compound's unique electronic properties, due to the electronegative fluorine atoms, can affect its interaction with biological targets. Overall, 3-fluoro-5-(trifluoromethyl)benzamide is a compound of interest in various fields, including medicinal chemistry and materials science, due to its distinctive structural features and potential applications.

Formula: C₈H₅F₄NO

InChI: InChI=1/C8H5F4NO/c9-6-2-4(7(13)14)1-5(3-6)8(10,11)12/h1-3H,(H2,13,14)

SMILES: c1c(cc(cc1C(F)(F)F)F)C(=N)O

Synonyms:

• alpha,alpha,alpha,5-Tetrafluoro-m-toluamide

Benzamide, 3-fluoro-5-(trifluoromethyl)-

CAS: 207986-20-7

Formula: C₈H₅F₄NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.1250

Ref: IN-DA002JEY

3-Fluoro-5-(trifluoromethyl)benzamide

CAS: 207986-20-7

3-Fluoro-5-(trifluoromethyl)benzamide

Formula: C₈H₅F₄NO

Purity: 97%

Color and Shape: white crystalline powder

Molecular weight: 207.13g/mol

Ref: 54-PC4371V

3-Fluoro-5-(trifluoromethyl)benzamide

CAS: 207986-20-7

Formula: C₈H₅F₄NO

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 207.128

Ref: 10-F006391