CAS 207986-25-2
:alpha-Bromo-4-(diethylamino)acetophenone
Description:
Alpha-Bromo-4-(diethylamino)acetophenone is an organic compound characterized by its structure, which includes a bromine atom, a ketone functional group, and a diethylamino substituent. This compound typically appears as a solid or crystalline substance and is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The diethylamino group contributes to its basicity and can influence its solubility in various solvents, often making it more soluble in polar organic solvents. The ketone functional group is indicative of its potential as a precursor in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific optical properties, making it useful in applications such as dye synthesis or as a reagent in chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks due to its reactivity and potential toxicity.
Formula:C12H16BrNO
InChI:InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3
SMILES:CCN(CC)c1ccc(cc1)C(=O)CBr
Synonyms:- 4-(Diethylamino)phenacyl bromide
- 2-Bromo-1-[4-(Diethylamino)Phenyl]Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4'-(diethylamino)acetophenone, 98%
CAS:2-Bromo-4'-(diethylamino)acetophenone, is used as a pharmaceutical intermediate. It is also used as a primary and secondary intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the
Formula:C12H16BrNOPurity:98%Color and Shape:Yellow to green, Crystals or powder or crystalline powder or fused solidMolecular weight:270.17Ethanone, 2-bromo-1-[4-(diethylamino)phenyl]-
CAS:Formula:C12H16BrNOPurity:98%Color and Shape:SolidMolecular weight:270.16554-(N,N-Diethylamino)phenacyl bromide
CAS:4-(N,N-Diethylamino)phenacyl bromideFormula:C12H16BrNOPurity:≥95%Color and Shape: yellow powderMolecular weight:270.17g/mol



