CAS 2080-32-2

N-[4-(diethylsulfamoyl)phenyl]acetamide

Description:

N-[4-(diethylsulfamoyl)phenyl]acetamide, with the CAS number 2080-32-2, is a chemical compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. This compound features a phenyl ring substituted with a diethylsulfamoyl group and an acetamide moiety, indicating it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the sulfonamide group suggests possible interactions with biological targets, such as enzymes or receptors, which could be significant in therapeutic applications. Additionally, the diethyl groups may influence the compound's solubility and lipophilicity, affecting its pharmacokinetics and bioavailability. The structural characteristics of this compound may also allow for various synthetic modifications, potentially leading to derivatives with enhanced efficacy or reduced toxicity. Overall, N-[4-(diethylsulfamoyl)phenyl]acetamide represents a compound of interest in the fields of organic and medicinal chemistry, warranting further investigation into its properties and applications.

Formula: C₁₂H₁₈N₂O₃S

InChI: InChI=1/C12H18N2O3S/c1-4-14(5-2)18(16,17)12-8-6-11(7-9-12)13-10(3)15/h6-9H,4-5H2,1-3H3,(H,13,15)

SMILES: CCN(CC)S(=O)(=O)c1ccc(cc1)N=C(C)O

Synonyms:

• Acetamide, N-[4-[(diethylamino)sulfonyl]phenyl]-

N,N-Diethyl-4-acetamidobenzenesulfonamide

CAS: 2080-32-2

Formula: C₁₂H₁₈N₂O₃S

Molecular weight: 270.35

Ref: 10-F037410