CAS 20802-57-7
:Pregna-3,5-diene-21-carboxylic acid, 17-hydroxy-3-methoxy-, γ-lactone, (17α)-
Description:
Pregna-3,5-diene-21-carboxylic acid, 17-hydroxy-3-methoxy-, γ-lactone, (17α)-, commonly known as a derivative of steroid compounds, exhibits several notable characteristics. This compound features a steroid backbone, which is characterized by a four-ring carbon structure. The presence of functional groups such as a carboxylic acid and a methoxy group contributes to its chemical reactivity and potential biological activity. The γ-lactone structure indicates a cyclic ester formation, which can influence the compound's solubility and stability. Additionally, the specific stereochemistry denoted by (17α)- suggests a particular spatial arrangement of atoms that may affect its interaction with biological targets, such as hormone receptors. This compound is often studied for its potential pharmacological properties, including anti-inflammatory and hormonal activities, making it of interest in medicinal chemistry and pharmacology. Its CAS number, 20802-57-7, allows for easy identification and retrieval of information in chemical databases.
Formula:C23H32O3
InChI:InChI=1/C23H32O3/c1-21-10-6-16(25-3)14-15(21)4-5-17-18(21)7-11-22(2)19(17)8-12-23(22)13-9-20(24)26-23/h4,14,17-19H,5-13H2,1-3H3
InChI key:InChIKey=OKMHWOWJDRPCCT-PZCAJWILSA-N
SMILES:C[C@@]12[C@@]3(CC[C@]1([C@]4([C@](CC2)([C@]5(C)C(=CC4)C=C(OC)CC5)[H])[H])[H])CCC(=O)O3
Synonyms:- 17α-Pregna-3,5-diene-21-carboxylic acid, 17-hydroxy-3-methoxy-, γ-lactone
- 3-Methoxypregna-3,5-diene-21,17alpha-carbolactone
- 3-methoxy-10,13-dimethyl-1,2,3',4',7,8,9,10,11,12,13,14,15,16-tetradecahydro-5'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-5'-one
- Pregna-3,5-diene-21-carboxylic acid, 17-hydroxy-3-methoxy-, γ-lactone, (17α)-
- (8R,9S,10R,13S,14S,17R)-3-methoxy-10,13-dimethyl-1,2,3',4',7,8,9,10,11,12,13,14,15,16-tetradecahydro-5'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-5'-one
- (2'R,8R,9S,10R,13S,14S)-3-methoxy-10,13-dimethyl-1,2,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-5'(4'H)-one
- (17R)-17-Hydroxy-3-methoxypregna-3,5-diene-21-carboxylic acid γ-lactone
- Einecs 244-047-7
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
