CAS 20804-76-6
:3-Hydroxy-4-(1-naphthalenyloxy)butanenitrile
Description:
3-Hydroxy-4-(1-naphthalenyloxy)butanenitrile, with the CAS number 20804-76-6, is a chemical compound characterized by its unique functional groups and structure. It features a hydroxyl group (-OH) and a nitrile group (-CN) attached to a butane backbone, along with a naphthalenyl ether moiety. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents due to the presence of the naphthalene ring, which contributes to its hydrophobic characteristics. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The nitrile group adds to its polarity and can engage in various chemical reactions, such as nucleophilic additions. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and structural properties. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c15-9-8-12(16)10-17-14-7-3-5-11-4-1-2-6-13(11)14/h1-7,12,16H,8,10H2
InChI key:InChIKey=ASZJWZSLVVSBAH-UHFFFAOYSA-N
SMILES:O(CC(CC#N)O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- 3-Hydroxy-4-(1-naphthalenyloxy)butanenitrile
- 3-Hydroxy-4-(1-naphthyloxy)-butanenitrile
- 3-Hydroxy-4-(Naphthalen-1-Yloxy)Butanenitrile
- Butanenitrile, 3-hydroxy-4-(1-naphthalenyloxy)-
- Butyronitrile, 3-hydroxy-4-(1-naphthyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Butanenitrile, 3-hydroxy-4-(1-naphthalenyloxy)-
CAS:Formula:C14H13NO2Color and Shape:SolidMolecular weight:227.25853-Hydroxy-4-(1-naphthyloxy)-butanenitrile
CAS:Controlled ProductApplications 3-Hydroxy-4-(1-naphthyloxy)-butanenitrile is an intermediate in the synthesis of Nadoxolol (N201040), which is a beta-adrenergic receptor blocker.
References Kappor, M., et al.: Bioorg. Chem., 31, 259 (2003)Formula:C14H13NO2Color and Shape:NeatMolecular weight:227.26

