CAS 208107-14-6
:3-(~2~H_3_)methyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide
Description:
3-(2H3)methyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide is a heterocyclic compound characterized by its complex ring structure, which includes imidazole and tetrazine moieties. This compound features a carboxamide functional group, contributing to its potential solubility in polar solvents and its reactivity in various chemical reactions. The presence of the methyl group indicates that it may exhibit specific steric and electronic properties, influencing its biological activity and interaction with other molecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of nitrogen-rich heterocycles, which are often associated with bioactivity. Additionally, the unique arrangement of atoms and functional groups may impart interesting optical or electronic properties, making it a candidate for further research in material science or as a dye. Overall, this compound's intricate structure and functional groups make it a subject of interest in various fields of chemistry and biochemistry.
Formula:C6H3D3N6O2
InChI:InChI=1/C6H6N6O2/c1-11-6(14)12-2-8-3(4(7)13)5(12)9-10-11/h2H,1H3,(H2,7,13)/i1D3
SMILES:C(n1c(=O)n2cnc(C(=O)N)c2nn1)([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Temozolomide-d3
CAS:Controlled ProductFormula:C6H3H3N6O2Color and Shape:Off White SolidMolecular weight:197.17Imidazo[5,1-d]-1,2,3,5-tetrazine-8-carboxamide, 3,4-dihydro-3-(methyl-d3)-4-oxo- (9CI)
CAS:Formula:C6H3D3N6O2Color and Shape:SolidMolecular weight:197.1693Temozolomide Impurity 18
CAS:Formula:C4H3N4O2·ClColor and Shape:Pale Pink SolidMolecular weight:139.09 35.45Ref: 4Z-T-3427
Discontinued product


