CymitQuimica logo

CAS 208118-13-2

:

2-benzyl-1H-benzimidazole-6-carboxylate

Description:
2-benzyl-1H-benzimidazole-6-carboxylate is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a benzyl group attached to the nitrogen of the benzimidazole, enhancing its lipophilicity and potentially influencing its biological activity. The carboxylate functional group at the 6-position contributes to its acidity and reactivity, making it a versatile intermediate in organic synthesis. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which can affect their application in various fields, including pharmaceuticals and agrochemicals. The presence of the benzimidazole moiety often correlates with a range of biological activities, including antimicrobial and anticancer properties. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is analyzed.
Formula:C15H11N2O2
InChI:InChI=1/C15H12N2O2/c18-15(19)11-6-7-12-13(9-11)17-14(16-12)8-10-4-2-1-3-5-10/h1-7,9H,8H2,(H,16,17)(H,18,19)/p-1
SMILES:c1ccc(cc1)Cc1nc2ccc(cc2[nH]1)C(=O)[O-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.