CAS 208176-32-3
:Benzoic acid, 5-amino-2-bromo-, ethyl ester
Description:
Benzoic acid, 5-amino-2-bromo-, ethyl ester, identified by CAS number 208176-32-3, is an organic compound characterized by its ester functional group, which is formed from benzoic acid and ethanol. This compound features a bromine atom and an amino group attached to the benzene ring, contributing to its unique chemical properties. The presence of the amino group can impart basic characteristics, while the bromine atom may influence reactivity and stability. Typically, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. In terms of solubility, esters generally exhibit moderate solubility in organic solvents and limited solubility in water, depending on the size and nature of the substituents. The compound may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and potential hazards, as with any chemical substance.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-2-13-9(12)7-5-6(11)3-4-8(7)10/h3-5H,2,11H2,1H3
InChI key:InChIKey=MOZORCINMBZQSL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Br)C=CC(N)=C1
Synonyms:- Benzoic acid, 5-amino-2-bromo-, ethyl ester
- Ethyl 2-bromo-5-aminobenzoate
- Ethyl 5-amino-2-bromobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 5-amino-2-bromobenzoate
CAS:Ethyl 5-amino-2-bromobenzoatePurity:97%Color and Shape:SolidMolecular weight:244.09g/mol5-Amino-2-bromobenzoic acid ethyl ester
CAS:5-Amino-2-bromobenzoic acid ethyl ester is a chemical compound that can be used for the production of pharmaceuticals and research chemicals. It is a versatile building block that can be used in the synthesis of complex compounds with valuable applications. 5-Amino-2-bromobenzoic acid ethyl ester is a reagent, speciality chemical, and useful building block that can be used in the synthesis of high quality compounds. This compound has been identified as an intermediate in organic reactions and as a reaction component. CAS No. 208176-32-3Formula:C9H10BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:244.09 g/mol


