CAS 208176-48-1
:Ethyl 4-(methylnitrosoamino)benzoate
Description:
Ethyl 4-(methylnitrosoamino)benzoate, identified by its CAS number 208176-48-1, is a chemical compound that belongs to the class of nitrosoamines, which are known for their potential carcinogenic properties. This compound features an ethyl ester functional group attached to a benzoate structure, along with a nitrosoamino group, which contributes to its biological activity. Ethyl 4-(methylnitrosoamino)benzoate is typically characterized by its molecular structure, which includes a benzene ring substituted with both an ethyl ester and a nitrosoamino group. The presence of the nitroso group is particularly significant, as it can participate in various chemical reactions, including those leading to the formation of DNA adducts, which are implicated in mutagenesis and cancer development. In terms of physical properties, nitrosoamines often exhibit low volatility and can be soluble in organic solvents. Due to their potential health risks, compounds like ethyl 4-(methylnitrosoamino)benzoate are subject to regulatory scrutiny and require careful handling in laboratory and industrial settings.
Formula:C10H12N2O3
InChI:InChI=1S/C10H12N2O3/c1-3-15-10(13)8-4-6-9(7-5-8)12(2)11-14/h4-7H,3H2,1-2H3
InChI key:InChIKey=AMNRBEHZXHVEJS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(N(N=O)C)C=C1
Synonyms:- Benzoic acid, 4-(methylnitrosoamino)-, ethyl ester
- Ethyl 4-(methylnitrosoamino)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Nitrosamine
CAS:Controlled ProductApplications Nitrosamine is useful as a research chemical.
Formula:C10H12N2O3Color and Shape:NeatMolecular weight:208.214


