CAS 20818-25-1
:P-aminophenyl-B-D-glucopyranoside
Description:
P-aminophenyl-β-D-glucopyranoside is a chemical compound that features a glucopyranoside moiety linked to an aminophenyl group. This compound is characterized by its structure, which includes a β-D-glucopyranoside unit, a six-membered cyclic sugar that is commonly found in various biological systems. The presence of the amino group (-NH2) on the phenyl ring contributes to its reactivity and potential biological activity, making it of interest in biochemical research. P-aminophenyl-β-D-glucopyranoside can participate in various chemical reactions, including glycosylation and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, it may exhibit properties such as solubility in polar solvents due to the hydroxyl groups in the glucopyranoside structure. This compound is often used in studies related to glycosylation processes and may serve as a substrate or intermediate in the synthesis of more complex molecules. Its CAS number, 20818-25-1, uniquely identifies it in chemical databases, facilitating research and application in various scientific fields.
Formula:C12H17NO6
InChI:InChI=1/C12H17NO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5,13H2/t8-,9-,10+,11-,12-/m1/s1
Synonyms:- 4-Aminophenyl glucoside
- 4-Aminophenyl-beta-D-glucopyranoside
- Papb-DG
- p-Aminophenyl-beta-D-glucoside
- beta-D-Glucopyranoside, 4-aminophenyl
- 4-Aminophenyl Hexopyranoside
- P-Aminophenyl beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
P-AMINOPHENYL β-D-GLUCOPYRANOSIDE
CAS:Formula:C12H17NO6Purity:96%Color and Shape:SolidMolecular weight:271.26654-Aminophenyl β-D-glucopyranoside
CAS:4-Aminophenyl β-D-glucopyranosidePurity:96%Color and Shape:White-Pale Yellow SolidMolecular weight:271.27g/mol4-Aminophenyl b-D-glucopyranoside
CAS:4-Aminophenyl b-D-glucopyranoside is a membrane transport inhibitor that prevents the uptake of glucose by inhibiting the enzyme hexose transporter. It is used in biological treatment and has been shown to be effective against glutamicum. 4-Aminophenyl b-D-glucopyranoside can also be used in assays to identify bacteria based on their surface antigens. This compound was isolated from corynebacterium glutamicum and its metabolic pathway has been elucidated. 4-Aminophenyl b-D-glucopyranoside has also been shown to inhibit enzymatic activity, which may be due to inhibition of the enzyme dihydroorotate dehydrogenase.Formula:C12H17NO6Purity:Min. 95%Color and Shape:White PowderMolecular weight:271.27 g/mol




