CAS 208186-71-4

4-Bromo-2-(trifluoromethyl)phenylthiourea

Description:

4-Bromo-2-(trifluoromethyl)phenylthiourea is an organic compound characterized by the presence of a bromine atom and a trifluoromethyl group attached to a phenyl ring, along with a thiourea functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the thiourea moiety, which is known for its biological activity. The bromine and trifluoromethyl substituents can influence the compound's electronic properties and reactivity, making it a subject of interest in various chemical reactions and synthesis processes. Additionally, the presence of fluorine atoms often enhances lipophilicity, which can affect the compound's bioavailability and interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-2-(trifluoromethyl)phenylthiourea represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₈H₆BrF₃N₂S

InChI: InChI=1/C8H6BrF3N2S/c9-4-1-2-6(14-7(13)15)5(3-4)8(10,11)12/h1-3H,(H3,13,14,15)

SMILES: c1cc(c(cc1Br)C(F)(F)F)NC(=N)S

Synonyms:

• 1-[4-Bromo-2-(Trifluoromethyl)Phenyl]Thiourea

Thiourea, N-[4-bromo-2-(trifluoromethyl)phenyl]-

CAS: 208186-71-4

Formula: C₈H₆BrF₃N₂S

Purity: 99%

Color and Shape: Solid

Molecular weight: 299.1108

Ref: IN-DA002JKF

4-Bromo-2-(trifluoromethyl)phenylthiourea

CAS: 208186-71-4

4-Bromo-2-(trifluoromethyl)phenylthiourea

Formula: C₈H₆BrF₃N₂S

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 299.11g/mol

Ref: 54-PC10383