CAS 20826-03-3

5-Methoxynicotinic acid

Description:

5-Methoxynicotinic acid is an aromatic compound that belongs to the class of nicotinic acids, which are derivatives of pyridine. It features a methoxy group (-OCH3) at the 5-position of the pyridine ring, contributing to its unique chemical properties. This compound is characterized by its carboxylic acid functional group (-COOH), which imparts acidic characteristics and allows for potential interactions in biochemical pathways. 5-Methoxynicotinic acid is known for its potential biological activities, including anti-inflammatory and neuroprotective effects, making it of interest in pharmaceutical research. It is typically soluble in polar solvents, such as water and alcohols, due to the presence of both the methoxy and carboxylic acid groups. The compound's molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in synthetic organic chemistry. Overall, 5-Methoxynicotinic acid serves as a valuable compound in both research and potential therapeutic applications.

Formula: C₇H₇NO₃

InChI: InChI=1S/C7H7NO3/c1-11-6-2-5(7(9)10)3-8-4-6/h2-4H,1H3,(H,9,10)

InChI key: InChIKey=VDZUWTLBWRZRTR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(OC)C=NC1

Synonyms:

• 3-Pyridinecarboxylic Acid, 5-Methoxy-
• 5-Methoxy-3-pyridinecarboxylic acid
• 5-Methoxynicotinic acid
• Nicotinic acid, 5-methoxy-
• 5-Methoxypyridine-3-carboxylic acid

3-Pyridinecarboxylic acid, 5-methoxy-

CAS: 20826-03-3

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA002JLU

5-Methoxynicotinic acid

CAS: 20826-03-3

5-Methoxynicotinic acid

Formula: C₇H₇NO₃

Purity: ≥95%

Color and Shape: off-white to light grey solid

Molecular weight: 153.14g/mol

Ref: 54-OR16421

5-Methoxynicotinic acid

CAS: 20826-03-3

Formula: C₇H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.137

Ref: 10-F065955