
CAS 20826-77-1
:trans-3-Methylcyclobutanamine
Description:
Trans-3-Methylcyclobutanamine is an organic compound characterized by its cyclic structure and the presence of an amine functional group. It features a cyclobutane ring with a methyl group attached at the third carbon position, and the "trans" designation indicates that the substituents are positioned on opposite sides of the ring. This compound is a chiral amine, which means it can exist in two enantiomeric forms. Its molecular formula typically includes carbon, hydrogen, and nitrogen atoms, reflecting its classification as an amine. Trans-3-Methylcyclobutanamine may exhibit properties such as solubility in polar solvents, and its reactivity can be influenced by the presence of the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The compound's unique structure may also impart specific physical properties, such as boiling and melting points, which are relevant for its applications in organic synthesis and potential pharmaceutical uses. However, detailed safety and handling information should be consulted due to the potential hazards associated with amines.
Formula:C5H11N
InChI:InChI=1/C5H11N/c1-4-2-5(6)3-4/h4-5H,2-3,6H2,1H3/t4-,5-
InChI key:InChIKey=GNHDRVDLNQEOPA-URHBZAFANA-N
SMILES:C[C@H]1C[C@H](N)C1
Synonyms:- Cyclobutanamine, 3-methyl-, trans-
- Cyclobutylamine, 3-methyl-, trans-
- trans-3-Methylcyclobutanamine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery