CAS 208346-80-9

Ethyl N-[[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]carbamate

Description:

Ethyl N-[[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]carbamate, identified by its CAS number 208346-80-9, is a chemical compound characterized by its unique structural features that include a carbamate functional group and a sugar moiety. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where glycosylated compounds often exhibit enhanced solubility and bioactivity. The presence of the 6-deoxy-α-L-mannopyranosyl group suggests that it may interact with biological systems in a manner similar to other glycosides, potentially influencing cellular processes or serving as a ligand for specific receptors. The ethyl carbamate portion contributes to its solubility and stability, making it suitable for various applications in pharmaceutical research. Overall, this compound exemplifies the intersection of carbohydrate chemistry and medicinal applications, highlighting the importance of structural modifications in enhancing the properties of bioactive molecules.

Formula: C₁₆H₂₃NO₇

InChI: InChI=1S/C16H23NO7/c1-3-22-16(21)17-8-10-4-6-11(7-5-10)24-15-14(20)13(19)12(18)9(2)23-15/h4-7,9,12-15,18-20H,3,8H2,1-2H3,(H,17,21)/t9-,12-,13+,14+,15-/m0/s1

InChI key: InChIKey=UNNZZQOFLFJJJZ-NBUQLFNLSA-N

SMILES: O([C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1)C2=CC=C(CNC(OCC)=O)C=C2

Synonyms:

• Carbamic acid, N-[[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]-, ethyl ester
• Ethyl N-[[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]carbamate
• Carbamic acid, [[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]-, ethyl ester

Carbamic acid, N-[[4-[(6-deoxy-α-L-mannopyranosyl)oxy]phenyl]methyl]-, ethyl ester

CAS: 208346-80-9

Formula: C₁₆H₂₃NO₇

Purity: 97.5%

Molecular weight: 341.3563

Ref: IN-DA01SKYQ

Ethyl 4-(rhamnosyloxy)benzylcarbamate

CAS: 208346-80-9

Ethyl 4-(rhamnosyloxy)benzylcarbamate is a natural product for research related to life sciences.

Formula: C₁₆H₂₃NO₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 341.36

Ref: TM-TN5683

Ethyl 4-(rhamnosyloxy)benzylcarbamate

CAS: 208346-80-9

Ethyl 4-(rhamnosyloxy)benzylcarbamate is a synthetic compound classified as a carbamate derivative. Its primary source is derived from rhamnosides, which are glycosylated molecules commonly found in various natural products, including plant-derived compounds. This synthesis involves modifying the carbohydrate moiety to enhance specific properties and interactions.

Formula: C₁₆H₂₃NO₇

Purity: Min. 95%

Molecular weight: 341.36 g/mol

Ref: 3D-IIA34680