CAS 2084-28-8
:Cyclohexanecarboxylic acid, 4-amino-, ethyl ester, hydrochloride (1:1), trans-
Description:
Cyclohexanecarboxylic acid, 4-amino-, ethyl ester, hydrochloride (1:1), trans- is a chemical compound characterized by its cyclic structure and functional groups. It features a cyclohexane ring substituted with a carboxylic acid and an amino group, along with an ethyl ester moiety. The presence of the hydrochloride indicates that the compound exists as a salt, which enhances its solubility in water and may influence its biological activity. The trans configuration suggests that the substituents on the cyclohexane ring are positioned opposite each other, which can affect the compound's steric properties and reactivity. This compound is likely to exhibit properties typical of amino acids and esters, such as potential biological activity, including roles in pharmaceuticals or as intermediates in organic synthesis. Its CAS number, 2084-28-8, allows for easy identification in chemical databases. Overall, this compound's unique structure and functional groups contribute to its potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H17NO2·ClH
InChI:InChI=1/C9H17NO2.ClH/c1-2-12-9(11)7-3-5-8(10)6-4-7;/h7-8H,2-6,10H2,1H3;1H/t7-,8-;
InChI key:InChIKey=UPVSMFHQPMRMLP-KMMPGQJCNA-N
SMILES:C(OCC)(=O)[C@H]1CC[C@H](N)CC1.Cl
Synonyms:- Cyclohexanecarboxylic acid, 4-amino-, ethyl ester, hydrochloride (1:1), trans-
- Cyclohexanecarboxylic acid, 4-amino-, ethyl ester, hydrochloride, trans-
- Ethyl trans-4-aminocyclohexanecarboxylate hydrochloride
- Ethyl trans-4-aminocyclohexanecarboxylate monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cyclohexanecarboxylic acid, 4-amino-, ethyl ester, hydrochloride (1:1), trans-
CAS:Formula:C9H18ClNO2Purity:95%Color and Shape:SolidMolecular weight:207.6977trans-Ethyl 4-aminocyclohexanecarboxylate hydrochloride
CAS:trans-Ethyl 4-aminocyclohexanecarboxylate hydrochloridePurity:95%Molecular weight:207.70g/moltrans-Ethyl 4-aminocyclohexanecarboxylate hydrochloride
CAS:Formula:C9H18ClNO2Purity:97%Color and Shape:LiquidMolecular weight:207.7Ethyl trans-4-Aminocyclohexanecarboxylate Hydrochloride
CAS:Controlled ProductApplications Ethyl trans-4-Aminocyclohexanecarboxylate is a cyclohexane carboxylate amino isomer. Ethyl trans-4-Aminocyclohexanecarboxylate is used in the synthesis of trans-4-(6-substituted-9-purinyl)cyclohexylcarbinols as inhibitors of adenosine deaminase.
References Schaeffer, H.J., et al.: J. Pharmaceut. Sci., 54, 421 (1965),Formula:C9H18ClNO2Color and Shape:NeatMolecular weight:207.7trans-Ethyl 4-aminocyclohexanecarboxylate hydrochloride
CAS:Versatile small molecule scaffoldFormula:C9H18ClNO2Purity:Min. 95%Molecular weight:207.7 g/mol




