CAS 20847-05-6
:6-azido-6-deoxy-D-glucose
Description:
6-Azido-6-deoxy-D-glucose is a derivative of glucose where the hydroxyl group at the sixth carbon is replaced by an azido group (-N3). This modification imparts unique chemical properties to the molecule, making it a valuable compound in various biochemical applications, particularly in the fields of glycobiology and medicinal chemistry. The azido group is known for its ability to participate in click chemistry reactions, allowing for the conjugation of other molecules, which is useful in drug development and bioconjugation techniques. The compound is typically a white to off-white solid and is soluble in polar solvents. Its reactivity is influenced by the presence of the azido group, which can undergo reduction to amine or participate in cycloaddition reactions. As a 6-deoxy sugar, it lacks the hydroxyl group at the sixth position, which alters its biological interactions compared to regular glucose. Safety and handling precautions should be observed due to the potential reactivity of the azido group.
Formula:C6H11N3O5
InChI:InChI=1/C6H11N3O5/c7-9-8-1-3(11)5(13)6(14)4(12)2-10/h2-6,11-14H,1H2/t3-,4+,5-,6-/m1/s1
Synonyms:- D-glucose, 6-azido-6-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2R,3S,4R,5R)-6-azido-2,3,4,5-tetrahydroxyhexanal
CAS:Formula:C6H11N3O5Purity:95%Molecular weight:205.16866-Azido-6-deoxy-D-glucopyranose
CAS:6-Azido-6-deoxy-D-glucopyranosePurity:>98%Color and Shape:White CrystalsMolecular weight:205.17g/mol6-Azido-6-deoxy-D-glucose
CAS:6-Azido-6-deoxy-D-glucose is a fluorescent compound that can be used as a probe for the visualization of glycosidase activity. The compound is synthesized from D-glucose by reacting it with 6-azidohexyl nitrate and sodium hydroxide in a chemoenzymatic reaction. This compound has been shown to bind to the cell nucleus, which can be observed using microscopy. The uptake of this compound into cells is dependent on the degree of polymerization, with monomers being taken up at a higher rate than oligomers or polymers. 6-Azido-6-deoxy-D-glucose is also an inhibitor of beta-cyclodextrin glycosidase, which prevents the hydrolysis of beta cyclodextrins.Formula:C6H11N3O5Purity:Min. 97 Area-%Color and Shape:Off-White PowderMolecular weight:205.17 g/mol



