CAS 208511-67-5

4-(1H-pyrazol-3-yl)benzoic acid

Description:

4-(1H-pyrazol-3-yl)benzoic acid, with the CAS number 208511-67-5, is an organic compound characterized by its pyrazole and benzoic acid moieties. This compound features a pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms, attached to a benzoic acid group, which consists of a benzene ring with a carboxylic acid functional group. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The pyrazole ring contributes to the compound's potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and can participate in hydrogen bonding due to the carboxylic acid group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and materials science, where it may serve as a building block for more complex molecules or as a ligand in coordination chemistry.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-3-1-7(2-4-8)9-5-6-11-12-9/h1-6H,(H,11,12)(H,13,14)

SMILES: c1cc(ccc1c1cc[nH]n1)C(=O)O

Synonyms:

• 3-(4-Carboxyphenyl)-1H-pyrazole
• 4-(1H-pyrazol-5-yl)benzoic acid

Benzoic acid, 4-(1H-pyrazol-3-yl)-

CAS: 208511-67-5

Formula: C₁₀H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA002JQ8

4-(1H-Pyrazol-3-yl)benzoic acid

CAS: 208511-67-5

4-(1H-Pyrazol-3-yl)benzoic acid

Purity: ≥95%

Color and Shape: Yellow Powder

Molecular weight: 188.18g/mol

Ref: 54-OR29

4-(1H-Pyrazol-5-yl)benzoic acid

CAS: 208511-67-5

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.186

Ref: 10-F309219