CAS 208519-38-4
:6-Chloro-5-hydroxy-4-[2-(trimethylsilyl)ethynyl]-2-pyridinemethanol
Description:
6-Chloro-5-hydroxy-4-[2-(trimethylsilyl)ethynyl]-2-pyridinemethanol is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a chloro group indicates that it has halogenated characteristics, which can influence its reactivity and solubility. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its interactions in biological systems. The trimethylsilyl group attached via an ethynyl linkage suggests that the compound may exhibit unique properties related to its stability and reactivity, particularly in organic synthesis and medicinal chemistry. This compound may also demonstrate interesting pharmacological activities due to its structural features, making it a candidate for further research in drug development. Its CAS number, 208519-38-4, allows for precise identification in chemical databases, facilitating access to its safety data, synthesis methods, and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H14ClNO2Si
InChI:InChI=1S/C11H14ClNO2Si/c1-16(2,3)5-4-8-6-9(7-14)13-11(12)10(8)15/h6,14-15H,7H2,1-3H3
InChI key:InChIKey=UPUKXPTXCGNQJR-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C=1C=C(CO)N=C(Cl)C1O
Synonyms:- 2-Chloro-6-(hydroxymethyl)-4-[(trimethylsilyl)ethynyl]-3-pyridinol
- 6-Chloro-5-hydroxy-4-[2-(trimethylsilyl)ethynyl]-2-pyridinemethanol
- 2-Pyridinemethanol, 6-chloro-5-hydroxy-4-[2-(trimethylsilyl)ethynyl]-
- 2-Chloro-6-(hydroxymethyl)-4-[2-(trimethylsilyl)ethynyl]pyridin-3-ol
- 2-Pyridinemethanol, 6-chloro-5-hydroxy-4-[(trimethylsilyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Chloro-6-methoxy-4-[2-(trimethylsilyl)ethynyl]-3-pyridinol
CAS:Formula:C11H14ClNO2SiMolecular weight:255.77292-Chloro-3-hydroxy-6-methoxy-4-[2-(trimethylsilyl)ethynyl]pyridine
CAS:2-Chloro-3-hydroxy-6-methoxy-4-[2-(trimethylsilyl)ethynyl]pyridineMolecular weight:255.77g/mol

