CAS 20853-56-9
:7-hydroxy-2-oxo-2H-chromen-8-yl beta-D-allopyranoside
Description:
7-Hydroxy-2-oxo-2H-chromen-8-yl beta-D-allopyranoside, with the CAS number 20853-56-9, is a glycoside compound derived from the flavonoid class, specifically a coumarin derivative. This substance features a chromen-2-one core structure, which is characterized by a benzopyran ring fused with a carbonyl group. The presence of the hydroxy group at the 7-position contributes to its potential biological activity, including antioxidant properties. The beta-D-allopyranoside moiety indicates that it is a glycoside, where the sugar component is linked to the aglycone via a beta-glycosidic bond. This compound is often studied for its pharmacological properties, including anti-inflammatory and antimicrobial effects. Its solubility and stability can vary depending on the pH and solvent used, which is important for its applications in pharmaceuticals and natural product chemistry. Overall, 7-hydroxy-2-oxo-2H-chromen-8-yl beta-D-allopyranoside represents a significant compound in the field of natural products and medicinal chemistry.
Formula:C15H16O9
InChI:InChI=1/C15H16O9/c16-5-8-10(19)11(20)12(21)15(22-8)24-14-7(17)3-1-6-2-4-9(18)23-13(6)14/h1-4,8,10-12,15-17,19-21H,5H2/t8-,10-,11-,12-,15+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8-(Β-D-Glucopyranosyloxy)-7-Hydroxy-2H-1-Benzopyran-2-One
CAS:Formula:C15H16O9Purity:98.0%Molecular weight:340.2821Daphnetin-8-glucoside
CAS:<p>Daphnetin-8-glucoside is a natural phenolic glucoside compound derived from plants of the Thymelaeaceae family, specifically from the Daphne genus. This compound is produced by the glycosylation of daphnetin, a coumarin derivative found in various botanical sources. The glycoside linkage enhances its solubility and stability, facilitating its bioavailability. Daphnetin-8-glucoside exhibits potent antioxidant and anti-inflammatory activities, mediated through the scavenging of free radicals and inhibition of pro-inflammatory cytokine production. Additionally, it modulates signal transduction pathways involved in cellular oxidative stress responses.</p>Formula:C15H16O9Purity:Min. 95%Color and Shape:PowderMolecular weight:340.28 g/mol8-(β-D-Glucopyranosyloxy)-7-Hydroxy-2H-1-Benzopyran-2-One
CAS:Controlled ProductFormula:C15H16O9Color and Shape:NeatMolecular weight:340.282


