CAS 20854-60-8

(4'-methoxybiphenyl-4-yl)methanol

Description:

(4'-Methoxybiphenyl-4-yl)methanol, with the CAS number 20854-60-8, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the para position of one of the phenyl rings enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. Additionally, the hydroxymethyl group (-CH2OH) attached to the biphenyl framework contributes to its potential as a building block in organic synthesis and materials science. This compound may exhibit interesting properties such as moderate polarity, which can affect its behavior in various chemical environments. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex organic molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data for precise applications and handling guidelines.

Formula: C₁₄H₁₄O₂

InChI: InChI=1/C14H14O2/c1-16-14-8-6-13(7-9-14)12-4-2-11(10-15)3-5-12/h2-9,15H,10H2,1H3

SMILES: COc1ccc(cc1)c1ccc(cc1)CO

Synonyms:

• [1,1'-Biphenyl]-4-methanol, 4'-methoxy-
• (4'-Methoxybiphenyl-4-yl)methanol

(4'-Methoxy-[1,1'-biphenyl]-4-yl)methanol

CAS: 20854-60-8

Formula: C₁₄H₁₄O₂

Purity: 95%

Molecular weight: 214.2598

Ref: IN-DA002JS6

(4'-Methoxy-biphenyl-4-yl)methanol

CAS: 20854-60-8

(4'-Methoxy-biphenyl-4-yl)methanol

Purity: 95%

Molecular weight: 214.26g/mol

Ref: 54-OR346494

(4′-Methoxy[1,1′-biphenyl]-4-yl)methanol

CAS: 20854-60-8

Formula: C₁₄H₁₄O₂

Purity: ≥95%

Molecular weight: 214.264

Ref: 10-F041788