CAS 20859-23-8

(S)-(-)-bromosuccinic acid

Description:

(S)-(-)-Bromosuccinic acid, with the CAS number 20859-23-8, is a chiral organic compound that belongs to the class of dicarboxylic acids. It features two carboxylic acid functional groups (-COOH) and a bromine atom attached to a succinic acid backbone, which contributes to its unique properties. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses. This compound is typically a white crystalline solid at room temperature and is soluble in water and organic solvents, reflecting its polar nature due to the carboxylic acid groups. The (S)-(-) designation indicates its specific stereochemistry, which can influence its biological activity and interactions in chemical reactions. Bromosuccinic acid can participate in various reactions, including nucleophilic substitutions and esterifications, and is often utilized in the synthesis of pharmaceuticals and agrochemicals. Its chiral nature also makes it of interest in asymmetric synthesis and the development of chiral catalysts.

Formula: C₄H₅BrO₄

InChI: InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1

SMILES: C([C@@H](C(=O)O)Br)C(=O)O

Synonyms:

• (2S)-2-bromobutanedioic acid

Butanedioic acid, 2-bromo-, (2S)-

CAS: 20859-23-8

Formula: C₄H₅BrO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 196.9841

Ref: IN-DA002JSK

(S)-(-)-2-Bromosuccinic acid

CAS: 20859-23-8

(S)-(-)-2-Bromosuccinic acid

Purity: 96%

Molecular weight: 196.98g/mol

Ref: 54-OR913781

(S)-(-)Bromosuccinic acid

CAS: 20859-23-8

Formula: C₄H₅BrO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 196.984

Ref: 10-F011595

(S)-2-Bromosuccinic Acid

Controlled Product

CAS: 20859-23-8

Formula: C₄H₅BrO₄

Color and Shape: Neat

Molecular weight: 196.984

Ref: TR-B688800

(S)-2-Bromosuccinic Acid

CAS: 20859-23-8

(S)-2-Bromosuccinic Acid is a chiral molecule that has been used in the synthesis of some pharmaceuticals. It has also been used as a cognitive enhancer and research chemical. The enantioselective synthesis of this compound is efficient, with an overall yield of 73%.

Formula: C₄H₅BrO₄

Purity: Min. 95%

Molecular weight: 196.98 g/mol

Ref: 3D-VAA85923