
CAS 2086-27-3
:4-[[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]methyl]benzonitrile
Description:
4-[[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]methyl]benzonitrile, with the CAS number 2086-27-3, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and a benzonitrile group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the dioxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks or redox processes. Its solubility can vary depending on the solvent, and it may demonstrate specific interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's functional groups may impart unique optical or electronic properties, which could be exploited in materials science or organic synthesis. Overall, 4-[[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]methyl]benzonitrile represents a versatile structure with potential applications across various fields of chemistry.
Formula:C16H10N2O3
InChI:InChI=1S/C16H10N2O3/c17-9-11-5-7-12(8-6-11)10-21-18-15(19)13-3-1-2-4-14(13)16(18)20/h1-8H,10H2
InChI key:InChIKey=VRWZNQITCNBJML-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1OCC3=CC=C(C#N)C=C3)=CC=CC2
Synonyms:- 4-[[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]methyl]benzonitrile
- Phthalimide, N-[(p-cyanobenzyl)oxy]-
- Benzonitrile, 4-[[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-[(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)oxy]methylbenzonitrile
CAS:Formula:C16H10N2O3Molecular weight:278.2622
