CAS 20862-83-3

2-(piperidin-2-yl)-1H-indole

Description:

2-(Piperidin-2-yl)-1H-indole, with the CAS number 20862-83-3, is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. This compound features a piperidine ring, a six-membered saturated nitrogen-containing heterocycle, attached to the indole at the 2-position. The presence of both the indole and piperidine moieties suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity due to the aromatic nature of the indole and the aliphatic piperidine, which can influence their solubility and permeability. Additionally, the nitrogen atoms in both rings can participate in hydrogen bonding, affecting their interaction with biological targets. The compound may also be studied for its potential effects on neurotransmitter systems, given the structural similarities to various psychoactive substances. Overall, 2-(piperidin-2-yl)-1H-indole represents a versatile scaffold for further chemical modifications and biological evaluations.

Formula: C₁₃H₁₆N₂

InChI: InChI=1/C13H16N2/c1-2-6-11-10(5-1)9-13(15-11)12-7-3-4-8-14-12/h1-2,5-6,9,12,14-15H,3-4,7-8H2

SMILES: c1ccc2c(c1)cc(C1CCCCN1)[nH]2

2-(PIPERIDIN-2-YL)-1H-INDOLE

CAS: 20862-83-3

Formula: C₁₃H₁₆N₂

Purity: 95.0%

Molecular weight: 200.285

Ref: 10-F332995

2-(Piperidin-2-yl)-1H-indole

Controlled Product

CAS: 20862-83-3

Formula: C₁₃H₁₆N₂

Color and Shape: Neat

Molecular weight: 200.28

Ref: TR-B450423

2-(Piperidin-2-yl)-1H-indole

CAS: 20862-83-3

Versatile small molecule scaffold

Formula: C₁₃H₁₆N₂

Purity: Min. 95%

Molecular weight: 200.28 g/mol

Ref: 3D-VAA86283