CymitQuimica logo

CAS 208665-95-6

:

3-bromo-4-isobutoxy-benzonitrile

Description:
3-Bromo-4-isobutoxy-benzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a nitrile functional group. The presence of the isobutoxy group contributes to its unique properties, influencing both its solubility and reactivity. This compound typically appears as a solid at room temperature and is often used in synthetic organic chemistry as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine atom can serve as a leaving group, enhancing its reactivity in certain conditions. Additionally, the nitrile group may impart polar characteristics, affecting its interactions with other molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-bromo-4-isobutoxy-benzonitrile is a versatile compound with significant implications in chemical synthesis and research.
Formula:C11H12BrNO
InChI:InChI=1/C11H12BrNO/c1-8(2)7-14-11-4-3-9(6-13)5-10(11)12/h3-5,8H,7H2,1-2H3
SMILES:CC(C)COc1ccc(cc1Br)C#N
Synonyms:
  • 3-Bromo-4-isobutoxybenzonitrile
  • Benzonitrile, 3-Bromo-4-(2-Methylpropoxy)-
  • 3-Bromo-4-(2-Methylpropoxy)Benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.