CymitQuimica logo

CAS 2086688-99-3

:

Propanoic acid, 3-[2-(2-carboxyethoxy)ethoxy]-, 1-(1,1-dimethylethyl) ester

Description:
Propanoic acid, 3-[2-(2-carboxyethoxy)ethoxy]-, 1-(1,1-dimethylethyl) ester, identified by CAS number 2086688-99-3, is an organic compound characterized by its ester functional group, which is formed from the reaction of propanoic acid and an alcohol. This compound features a complex structure that includes multiple ethoxy groups and a tert-butyl group, contributing to its unique chemical properties. It is likely to be a colorless to pale yellow liquid, exhibiting moderate solubility in polar solvents due to the presence of carboxylic acid functionalities. The presence of multiple functional groups suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as a chemical intermediate in organic synthesis. Its specific characteristics, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the overall structure, which can be further explored through experimental data or computational modeling.
Formula:C12H22O6
InChI:InChI=1S/C12H22O6/c1-12(2,3)18-11(15)5-7-17-9-8-16-6-4-10(13)14/h4-9H2,1-3H3,(H,13,14)
InChI key:InChIKey=FVMOAKLTZMCDOV-UHFFFAOYSA-N
SMILES:O(C(CCOCCOCCC(O)=O)=O)C(C)(C)C
Synonyms:
  • Propanoic acid, 3-[2-(2-carboxyethoxy)ethoxy]-, 1-(1,1-dimethylethyl) ester
Found 5 products.