CAS 2086689-03-2

Methyl 3-[2-[2-[2-(aminooxy)ethoxy]ethoxy]ethoxy]propanoate

Description:

Methyl 3-[2-[2-[2-(aminooxy)ethoxy]ethoxy]ethoxy]propanoate, identified by its CAS number 2086689-03-2, is a synthetic organic compound characterized by its complex structure, which includes multiple ethoxy groups and an aminooxy functional group. This compound is likely to exhibit properties typical of esters, such as being a colorless to pale yellow liquid with a pleasant odor. The presence of the aminooxy group suggests potential reactivity, particularly in forming covalent bonds with carbonyl compounds, making it useful in various chemical applications, including bioconjugation and drug delivery systems. Its solubility in polar solvents is expected due to the ethoxy chains, while the ester functionality may impart some hydrophobic characteristics. Additionally, the compound's molecular structure indicates potential biological activity, which could be explored in medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and to mitigate any risks associated with exposure.

Formula: C₁₀H₂₁NO₆

InChI: InChI=1S/C10H21NO6/c1-13-10(12)2-3-14-4-5-15-6-7-16-8-9-17-11/h2-9,11H2,1H3

InChI key: InChIKey=KYJYDNKATOCUIR-UHFFFAOYSA-N

SMILES: O(CCC(OC)=O)CCOCCOCCON

Synonyms:

• Methyl 3-[2-[2-[2-(aminooxy)ethoxy]ethoxy]ethoxy]propanoate
• Propanoic acid, 3-[2-[2-[2-(aminooxy)ethoxy]ethoxy]ethoxy]-, methyl ester

Aminooxy-PEG3-methyl ester

CAS: 2086689-03-2

Aminooxy-PEG3-methyl ester, a PEG-based PROTAC linker, serves as a pivotal element in the synthesis of PROTACs[1].

Formula: C₁₀H₂₁NO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 251.28

Ref: TM-T14268