CAS 20872-93-9

7-NITRO-4-HYDROXYQUINONAZOLINE

Description:

7-Nitro-4-hydroxyquinonazoline is a chemical compound characterized by its unique structure, which includes a quinonazoline core with a nitro group and a hydroxyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the nitro group often imparts electron-withdrawing characteristics, which can influence the compound's reactivity in various chemical reactions. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents and potentially affecting its interaction with biological systems. 7-Nitro-4-hydroxyquinonazoline may be of interest in medicinal chemistry and research due to its potential pharmacological properties, including antimicrobial or anticancer activities. However, specific applications and safety considerations would depend on further studies and evaluations. As with any chemical substance, proper handling and safety protocols should be observed, given the potential hazards associated with nitro compounds.

Formula: C₈H₅N₃O₃

InChI: InChI=1/C8H5N3O3/c12-8-6-2-1-5(11(13)14)3-7(6)9-4-10-8/h1-4H,(H,9,10,12)

Synonyms:

• 7-Nitro-4-quinazolinol
• 7-nitroquinazolin-4(1H)-one
• 7-Nitroquinazolin-4(3H)-one

4(3H)​-​Quinazolinone, 7-​nitro-

CAS: 20872-93-9

Formula: C₈H₅N₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.1436

Ref: IN-DA002JVI

7-Nitroquinazolin-4(3H)-one

CAS: 20872-93-9

7-Nitroquinazolin-4(3H)-one

Purity: 99%

Molecular weight: 191.14g/mol

Ref: 54-OR61258

4-HYDROXY-7-NITROQUINAZOLINE

CAS: 20872-93-9

Formula: C₈H₅N₃O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.146

Ref: 10-F306352