CAS 20873-58-9
:5-(methylsulfanyl)thiophene-2-carboxylic acid
Description:
5-(Methylsulfanyl)thiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a methylsulfanyl group (-S-CH3) at the 5-position and a carboxylic acid group (-COOH) at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid functionality. It exhibits acidic behavior, allowing it to participate in various chemical reactions, such as esterification and amidation. The methylsulfanyl group can also influence the compound's reactivity and stability, making it of interest in synthetic organic chemistry and materials science. Additionally, compounds like this may have potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific interactions and reactivity can be further explored through various analytical techniques, including NMR and mass spectrometry, to understand its behavior in different chemical environments.
Formula:C6H6O2S2
InChI:InChI=1/C6H6O2S2/c1-9-5-3-2-4(10-5)6(7)8/h2-3H,1H3,(H,7,8)
SMILES:CSc1ccc(C(=O)O)s1
Synonyms:- 2-Thiophenecarboxylic Acid, 5-(Methylthio)-
- 5-(Methylthio)Thiophene-2-Carboxylic Acid
- 5-(Methylsulfanyl)thiophene-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(Methylthio)thiophene-2-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6O2S2Purity:97%Molecular weight:174.232-Thiophenecarboxylic acid, 5-(methylthio)-
CAS:Formula:C6H6O2S2Purity:98%Color and Shape:SolidMolecular weight:174.24065-(Methylthio)thiophene-2-carboxylic acid
CAS:5-(Methylthio)thiophene-2-carboxylic acid
Molecular weight:174.24g/mol5-Methylsulfanylthiophene-2-carboxylic acid
CAS:Formula:C6H6O2S2Purity:98%Color and Shape:SolidMolecular weight:174.235-Methylsulfanylthiophene-2-carboxylic acid
CAS:Versatile small molecule scaffoldFormula:C6H6O2S2Purity:Min. 95%Molecular weight:174.23 g/mol




