CAS 20876-36-2

5-Aminooxindole

Description:

5-Aminooxindole is an organic compound characterized by its oxindole structure, which features a fused benzene and pyrrolidine ring. It contains an amino group (-NH2) at the 5-position of the oxindole framework, contributing to its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which can facilitate its use in various chemical reactions and applications. 5-Aminooxindole has garnered interest in medicinal chemistry due to its potential as a building block for the synthesis of various pharmaceuticals, particularly in the development of compounds with anticancer and anti-inflammatory properties. Its reactivity is influenced by the presence of the amino group, which can participate in further chemical transformations, including coupling reactions and modifications to enhance biological activity. Overall, 5-Aminooxindole serves as a versatile intermediate in organic synthesis and medicinal chemistry research.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-3H,4,9H2,(H,10,11)

SMILES: c1cc2c(cc1N)CC(=O)N2

Synonyms:

• 5-Aminoindolin-2-One
• 5-amino-1,3-dihydro-2H-indol-2-one
• 5-Amino-1,3-dihydro-indol-2-one
• 5-amino-2,3-dihydro-1H-indol-2-one

2H-Indol-2-one, 5-amino-1,3-dihydro-

CAS: 20876-36-2

Formula: C₈H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA002JV3

5-Aminooxindole

CAS: 20876-36-2

Formula: C₈H₈N₂O

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Brown powder to crystalline

Molecular weight: 148.17

Ref: 3B-A2668

5-Amino-2-oxindole

CAS: 20876-36-2

5-Amino-2-oxindole

Formula: C₈H₈N₂O

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 148.16g/mol

Ref: 54-OR10335

5-Aminooxindole

CAS: 20876-36-2

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.165

Ref: 10-F043651