CAS 20876-37-3

benzyl 3-nitro-O-tolyl ether

Description:

Benzyl 3-nitro-O-tolyl ether is an organic compound characterized by the presence of a benzyl group, a nitro group, and an O-tolyl ether moiety. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The compound features a nitro group (-NO2) attached to the aromatic ring, which can influence its reactivity and polarity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The ether functional group contributes to its solubility properties, often making it soluble in organic solvents while being less soluble in water. This compound may be used in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to serve as an intermediate in various chemical syntheses. As with many nitro compounds, it may exhibit sensitivity to heat and shock, necessitating careful handling and storage. Always consult safety data sheets and relevant literature for specific handling and safety guidelines.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-11-13(15(16)17)8-5-9-14(11)18-10-12-6-3-2-4-7-12/h2-9H,10H2,1H3

SMILES: Cc1c(cccc1OCc1ccccc1)N(=O)=O

Synonyms:

• 3-Nitro-2-Methyl Phenol Benzyl Ether
• 1-(Benzyloxy)-2-Methyl-3-Nitrobenzene

Benzene, 2-methyl-1-nitro-3-(phenylmethoxy)-

CAS: 20876-37-3

Formula: C₁₄H₁₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.2579

Ref: IN-DA002JWA

1-Benzyloxy-2-methyl-3-nitrobenzene

CAS: 20876-37-3

1-Benzyloxy-2-methyl-3-nitrobenzene

Purity: 99%

Molecular weight: 243.26g/mol

Ref: 54-OR95763

2-Benzyloxy-6-nitrotoluene

CAS: 20876-37-3

2-Benzyloxy-6-nitrotoluene is an organic compound that has the formula CHNO. It is a white solid that is soluble in alcohols and ethers, but not in water. The compound is of interest as a precursor to other compounds.

Formula: C₁₄H₁₃NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 243.26 g/mol

Ref: 3D-FB71045

1-Benzyloxy-2-methyl-3-nitrobenzene

CAS: 20876-37-3

Formula: C₁₄H₁₃NO₃

Purity: 97%

Molecular weight: 243.262

Ref: 10-F077839