CAS 20876-99-7
:4-hydroxy-N,N-dimethylbenzamide
Description:
4-Hydroxy-N,N-dimethylbenzamide, with the CAS number 20876-99-7, is an organic compound characterized by its amide functional group and a hydroxyl group attached to a benzene ring. This compound features a dimethyl substitution on the nitrogen atom of the amide, which influences its solubility and reactivity. It typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group. The compound exhibits properties such as moderate melting and boiling points, which are common for amides. Its structure allows for potential hydrogen bonding, contributing to its solubility and interaction with other molecules. 4-Hydroxy-N,N-dimethylbenzamide may be used in various applications, including pharmaceuticals and chemical synthesis, due to its functional groups that can participate in further chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-10(2)9(12)7-3-5-8(11)6-4-7/h3-6,11H,1-2H3
SMILES:CN(C)C(=O)c1ccc(cc1)O
Synonyms:- benzamide, 4-hydroxy-N,N-dimethyl-
- 4-Hydroxy-N,N-dimethylbenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzamide, 4-hydroxy-N,N-dimethyl-
CAS:Formula:C9H11NO2Purity:98%Color and Shape:SolidMolecular weight:165.18914-Hydroxy-N,N-dimethylbenzamide
CAS:4-Hydroxy-N,N-dimethylbenzamidePurity:98%Molecular weight:165.19g/mol4-hydroxy-N,N-dimethylbenzamide
CAS:Formula:C9H11NO2Purity:98%Color and Shape:SolidMolecular weight:165.1924-hydroxy-N,N-dimethylbenzamide
CAS:4-Hydroxy-N,N-dimethylbenzamide is a synthetic agonist of the peroxisome proliferator-activated receptor gamma (PPARγ). It is structurally related to other PPARγ agonists such as amide and piperazine. The intraperitoneal administration of 4-hydroxy-N,N-dimethylbenzamide in mice has been shown to decrease intraperitoneal glucose levels and increase the level of glycolytic enzymes. The PPARγ agonist activity of 4-hydroxy-N,N-dimethylbenzamide has been demonstrated using an experiment that involved synthesizing spirocyclic compounds. These compounds were then tested for their ability to catalyze the isotope exchange between methylene protons and deuterium atoms. This process is called catalysis. Finally, 4-hydroxyn,N,N-dimethylbenzamide was tested for agonistic activity on carboxFormula:C9H11NO2Purity:Min. 95%Molecular weight:165.19 g/mol



