CAS 208764-53-8: Quinquenoside III

Description:Quinquenoside III, with the CAS number 208764-53-8, is a chemical compound that belongs to the class of saponins, which are glycosides with surfactant properties. It is primarily derived from plant sources, particularly within the genus Panax, known for its medicinal properties. Quinquenoside III is characterized by its complex structure, which typically includes a steroid or triterpenoid aglycone linked to one or more sugar moieties. This compound exhibits various biological activities, including potential anti-inflammatory, antioxidant, and immunomodulatory effects, making it of interest in pharmacological research. Its solubility in water and organic solvents can vary, influencing its bioavailability and efficacy in biological systems. Additionally, Quinquenoside III may interact with cellular membranes due to its surfactant nature, which can affect its mechanism of action in therapeutic applications. As with many saponins, it is essential to consider its dosage and potential side effects when evaluating its use in health-related contexts.

Formula:C₅₀H₈₄O₁₉

InChI:InChI=1S/C50H84O19/c1-23(2)11-10-15-50(9,69-44-41(62)38(59)35(56)28(21-52)65-44)25-12-17-49(8)33(25)26(54)19-31-47(6)16-14-32(46(4,5)30(47)13-18-48(31,49)7)67-45-42(39(60)36(57)29(66-45)22-63-24(3)53)68-43-40(61)37(58)34(55)27(20-51)64-43/h11,25-45,51-52,54-62H,10,12-22H2,1-9H3/t25-,26+,27+,28+,29+,30-,31+,32-,33-,34+,35+,36+,37-,38-,39-,40+,41+,42+,43-,44-,45-,47-,48+,49+,50-/m0/s1

InChI key:InChIKey=PXHNTRFQGHWVGX-ZQQZZLNPSA-N

SMILES:O=C(OCC1OC(OC2CCC3(C)C(CCC4(C)C3CC(O)C5C(CCC54C)C(OC6OC(CO)C(O)C(O)C6O)(C)CCC=C(C)C)C2(C)C)C(OC7OC(CO)C(O)C(O)C7O)C(O)C1O)C

Synonyms:
Quinquenoside III
β-D-Glucopyranoside, (3β,12β)-20-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-, 6-acetate
QuinquenosideIII