CymitQuimica logo

CAS 208772-24-1

:

7-Benzoxazolecarboxylic acid

Description:
7-Benzoxazolecarboxylic acid is an organic compound characterized by its benzoxazole ring structure, which is a fused bicyclic system containing both a benzene and an oxazole moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and organic solvents. It is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its ability to participate in various chemical reactions, including carboxylation and condensation reactions. The presence of the carboxylic acid functional group contributes to its acidity and reactivity, making it a useful intermediate in the synthesis of more complex molecules. Additionally, compounds with benzoxazole structures often display interesting biological activities, including antimicrobial and anti-inflammatory properties, which further enhances their significance in medicinal chemistry. Overall, 7-benzoxazolecarboxylic acid is a versatile compound with notable chemical and biological characteristics.
Formula:C8H5NO3
InChI:InChI=1S/C8H5NO3/c10-8(11)5-2-1-3-6-7(5)12-4-9-6/h1-4H,(H,10,11)
InChI key:InChIKey=JHTQTAYWCUAENJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N=CO2)=CC=C1
Synonyms:
  • 1,3-Benzoxazole-7-carboxylic acid
  • 7-Benzoxazolecarboxylic acid
Found 5 products.