CAS 20880-67-5
:(2S,5R,6R)-6-{[(4-hydroxyphenoxy)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Description:
The chemical substance with the name "(2S,5R,6R)-6-{[(4-hydroxyphenoxy)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid" and CAS number "20880-67-5" is a complex bicyclic compound that belongs to the class of beta-lactam antibiotics. It features a thiazolidine ring, which contributes to its structural uniqueness and biological activity. The presence of a carboxylic acid group enhances its solubility and potential reactivity, while the acetylamino and hydroxyphenoxy substituents may influence its pharmacological properties, including antibacterial efficacy. This compound exhibits chirality, with specific stereocenters that are crucial for its biological function and interaction with target enzymes, such as transpeptidases involved in bacterial cell wall synthesis. Its structural complexity and functional groups suggest potential applications in medicinal chemistry, particularly in the development of new antibiotics or derivatives with improved activity and reduced resistance. Overall, this compound represents a significant interest in the field of pharmaceutical chemistry due to its potential therapeutic applications.
Formula:C16H18N2O6S
InChI:InChI=1/C16H18N2O6S/c1-16(2)12(15(22)23)18-13(21)11(14(18)25-16)17-10(20)7-24-9-5-3-8(19)4-6-9/h3-6,11-12,14,19H,7H2,1-2H3,(H,17,20)(H,22,23)/t11-,12+,14-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenoxymethylpenicillin EP Impurity D
CAS:Formula:C16H18N2O6SColor and Shape:White To Off-White SolidMolecular weight:366.39(2S,5R,6R)-3,3-Dimethyl-7-oxo-6-[[2-(4-hydroxyphenoxy)acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic Acid (4-Hydroxyphenoxymethylpenicillin)
CAS:Formula:C16H18N2O6SColor and Shape:NeatMolecular weight:366.39p-Hydroxypenicillin V (~90%)
CAS:<p>Stability Unstable in Solution<br>Applications p-Hydroxypenicillin V is a byproduct in the synthesis of Penicillin V (P223500), an antibacterial agent.<br>References Goldenthal, E.I., et al.: Toxicol. Appl. Pharmacol., 18, 185 (1971), Dunham, J.M., et al.: Anal. Profiles Drug Subs., 1, 249 (1972),<br></p>Formula:C16H18N2O6SPurity:~90%Color and Shape:White To Off-WhiteMolecular weight:366.39p-Hydroxypenicillin V-d4
CAS:Controlled ProductFormula:C16D4H14N2O6SColor and Shape:NeatMolecular weight:370.414



