CAS 20880-92-6: 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose
Description:2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose is a carbohydrate derivative, specifically a protected form of β-D-fructopyranose. This compound features two isopropylidene protecting groups, which enhance its stability and solubility in organic solvents, making it useful in synthetic organic chemistry. The presence of these protecting groups allows for selective reactions at other functional sites on the fructose molecule, facilitating the synthesis of more complex carbohydrates or derivatives. The compound is typically a white to off-white solid and is soluble in common organic solvents such as methanol and dichloromethane. Its structure includes a pyranose ring, characteristic of many sugars, and it retains the functional properties of fructose while being modified for specific chemical applications. The compound is often used in carbohydrate chemistry for the synthesis of glycosides or in the preparation of other sugar derivatives. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C12H20O6
InChI:InChI=1S/C12H20O6/c1-10(2)15-7-5-14-12(6-13)9(8(7)16-10)17-11(3,4)18-12/h7-9,13H,5-6H2,1-4H3/t7-,8-,9+,12+/m1/s1
InChI key:InChIKey=PSSHGMIAIUYOJF-XBWDGYHZSA-N
SMILES:OCC12OCC3OC(OC3C2OC(O1)(C)C)(C)C
- Synonyms:
- 2,3,4,5-Di-O-isopropylidene-b-D-fructo pyranose
- 2,3:4,5-Bis-O-(1-methylethylidene)-b-D-fructopyranose
- 2,3:4,5-Bis-O-(1-methylethylidene)-β-<span class="text-smallcaps">D</span>-fructopyranose
- 2,3:4,5-Di-O-isopropylidene-β-<span class="text-smallcaps">D</span>-fructopyranose
- 2,3:4,5-bis-O-(1-methylethylidene)-β-D-fructopyranose Diacetonefructose
- 5H-Bis[1,3]dioxolo[4,5-b:4′,5′-d]pyran, β-<span class="text-smallcaps">D</span>-fructopyranose deriv.
- <span class="text-smallcaps">D</span>-Fructopyranose diacetonide
- Diacetonefructose
- Fructopyranose, 2,3:4,5-di-O-isopropylidene-, β-<span class="text-smallcaps">D</span>-
- NSC 407023
- See more synonyms
- β-<span class="text-smallcaps">D</span>-Fructopyranose, 2,3:4,5-bis-O-(1-methylethylidene)-
- 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose
- β-D-Fructopyranose, 2,3:4,5-bis-O-(1-methylethylidene)-
- 5H-Bis[1,3]dioxolo[4,5-b:4′,5′-d]pyran, β-D-fructopyranose deriv.
- Fructopyranose, 2,3:4,5-di-O-isopropylidene-, β-D-
