CAS 20883-96-9
:Methyl 3-(thien-2-yl)acrylate
Description:
Methyl 3-(thien-2-yl)acrylate is an organic compound characterized by its acrylate structure, which includes a methyl ester group and a thienyl substituent. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is known for its applications in organic synthesis, particularly in the production of various polymers and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Methyl 3-(thien-2-yl)acrylate is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. Its reactivity is influenced by the presence of the double bond in the acrylate moiety, making it susceptible to polymerization and other addition reactions. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C8H8O2S
InChI:InChI=1/C8H8O2S/c1-10-8(9)5-4-7-3-2-6-11-7/h2-6H,1H3/b5-4+
Synonyms:- Methyl 3-Thiophen-2-Ylprop-2-Enoate
- methyl (2E)-3-thiophen-2-ylprop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 3-(thien-2-yl)acrylate
CAS:Formula:C8H8O2SPurity:98%Color and Shape:SolidMolecular weight:168.2129Methyl 3-[2-Thienyl)propenoate
CAS:Controlled ProductApplications Methyl 3-[2-Thienyl)propenoate (cas# 20883-96-9) is a compound useful in organic synthesis.
Formula:C8H8O2SColor and Shape:NeatMolecular weight:168.21


