CAS 2089-36-3
:Piperonaldoxime
Description:
Piperonaldoxime, with the CAS number 2089-36-3, is an organic compound characterized by its oxime functional group attached to a piperonal structure. It typically appears as a white to off-white crystalline solid. The compound is known for its potential applications in organic synthesis and as an intermediate in the production of various chemicals. Piperonaldoxime exhibits moderate solubility in polar solvents, which is common for oxime derivatives, and it may have some degree of reactivity due to the presence of the oxime functional group, which can participate in various chemical reactions, including condensation and rearrangement. Additionally, it may possess biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and exposure risks, as with any chemical substance. Overall, piperonaldoxime is a versatile compound with relevance in both industrial and research settings.
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-4,10H,5H2/b9-4+
InChI key:InChIKey=VDAJDWUTRXNYMU-UHFFFAOYSA-N
SMILES:C(=NO)C=1C=C2C(=CC1)OCO2
Synonyms:- 1,3-Benzodioxole-5-Carbaldehyde Oxime
- 1,3-Benzodioxole-5-carboxaldehyde oxime
- 1,3-Benzodioxole-5-carboxaldoxime~3,4-(Methylenedioxy)benzaldoxime
- 1-(1,3-benzodioxol-5-yl)-N-hydroxymethanimine
- 3,4-Methylenedioxybenzaldehyde oxime
- 3,4-Methylenedioxybenzaldoxime
- NSC 27012
- Piperonal, oxime
- Piperonaldoxime, (3,4-Methylenedioxybenzaldoxime)
- Piperonaldoxime
- AKOS B004101
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Piperonal oxime
CAS:Controlled ProductPiperonal oxime is a chemical compound that is used in the synthesis of the fragrance piperonal. It can be produced by the reaction of sodium carbonate and piperonal with an aldehyde such as n-propyl chloride. Piperonal oxime can also be produced by refluxing piperonal in water with sodium carbonate, followed by acidification and polymerization. Piperonal oxime is insoluble in water and has a melting point range between 118-121 °C. The compound has been shown to catalyze the oxidation of benzaldehyde to benzoic acid and o-xylene to ortho-xylene, which are useful for the production of polymers such as nylon 6.Formula:C8H7NO3Purity:Min. 90%Molecular weight:165.15 g/mol

