CAS 2089-89-6

2,7-Naphthalenedicarboxylic acid

Description:

2,7-Naphthalenedicarboxylic acid, with the CAS number 2089-89-6, is an aromatic dicarboxylic acid characterized by its two carboxylic acid functional groups (-COOH) attached to the naphthalene ring at the 2 and 7 positions. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It has a relatively high melting point, indicative of strong intermolecular interactions due to hydrogen bonding from the carboxylic acid groups. 2,7-Naphthalenedicarboxylic acid is used in various applications, including the synthesis of polyesters, as a building block in organic synthesis, and in the production of certain dyes and pigments. Its structure allows for potential applications in materials science, particularly in the development of polymers with enhanced thermal and mechanical properties. Additionally, it exhibits potential biological activity, making it of interest in medicinal chemistry.

Formula: C₁₂H₈O₄

InChI: InChI=1S/C12H8O4/c13-11(14)8-3-1-7-2-4-9(12(15)16)6-10(7)5-8/h1-6H,(H,13,14)(H,15,16)

InChI key: InChIKey=WPUMVKJOWWJPRK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(C=CC(C(O)=O)=C2)C=C1

Synonyms:

• Naphthalene-2,7-Dicarboxylic Acid
• 2,7-Naphthalenedicarboxylic acid

Naphthalene-2,7-dicarboxylic acid

CAS: 2089-89-6

Formula: C₁₂H₈O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.1895

Ref: IN-DA002JY6

2,7-Naphthalenedicarboxylic acid

CAS: 2089-89-6

2,7-Naphthalenedicarboxylic acid

Purity: 99%

Molecular weight: 216.19g/mol

Ref: 54-OR470782

Naphthalene-2,7-dicarboxylic acid

CAS: 2089-89-6

Formula: C₁₂H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.192

Ref: 10-F092254

2,7-Naphthalenedicarboxylicacid

CAS: 2089-89-6

2,7-Naphthalenedicarboxylic acid is a synthetic compound that belongs to the group of aromatic hydrocarbons. It has been shown to have magnetic resonance spectroscopy (MRS) and X-ray structures that are similar to those of phenyl substituents. 2,7-Naphthalenedicarboxylic acid also shows supramolecular interactions with other molecules. The asymmetry can be explained by the presence of a nitrogen atom in the molecule, which can form intramolecular hydrogen bonds.

Formula: C₁₂H₈O₄

Purity: Min. 95%

Molecular weight: 216.19 g/mol

Ref: 3D-FN152156