CAS 208944-53-0

ethyl 1-(3,4-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxylate

Description:

Ethyl 1-(3,4-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of the 3,4-dichlorophenyl substituent enhances its biological activity and may influence its interaction with various biological targets. The methyl group at the 5-position of the pyrazole ring can affect the compound's steric and electronic properties, potentially impacting its pharmacological profile. Ethyl 1-(3,4-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxylate is often studied for its potential applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Its molecular structure suggests it may exhibit specific biological activities, making it a subject of interest in research focused on drug discovery and development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₃H₁₂Cl₂N₂O₂

InChI: InChI=1/C13H12Cl2N2O2/c1-3-19-13(18)10-7-16-17(8(10)2)9-4-5-11(14)12(15)6-9/h4-7H,3H2,1-2H3

SMILES: CCOC(=O)c1cnn(c1C)c1ccc(c(c1)Cl)Cl

ethyl 1-(3,4-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxylate

CAS: 208944-53-0

ethyl 1-(3,4-dichlorophenyl)-5-methyl-1H-pyrazole-4-carboxylate

Purity: ≥95%

Molecular weight: 299.15g/mol

Ref: 54-OR21675