CymitQuimica logo

CAS 2089649-33-0

:

2,7-Diazaspiro[4.4]nonane-2,9-dicarboxylic acid, 7-(phenylmethyl)-, 2-(1,1-dimethylethyl) 9-ethyl ester

Description:
2,7-Diazaspiro[4.4]nonane-2,9-dicarboxylic acid, 7-(phenylmethyl)-, 2-(1,1-dimethylethyl) 9-ethyl ester is a complex organic compound characterized by its spirocyclic structure, which features a diazabicyclic framework. This compound contains multiple functional groups, including carboxylic acid and ester moieties, contributing to its potential reactivity and solubility properties. The presence of a phenylmethyl group and a tert-butyl substituent suggests that the compound may exhibit hydrophobic characteristics, while the ethyl ester group can influence its lipophilicity and biological activity. The spiro structure may impart unique conformational properties, potentially affecting its interaction with biological targets. Additionally, the compound's molecular architecture may allow for various synthetic modifications, making it of interest in medicinal chemistry and drug design. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in various fields.
Formula:C22H32N2O4
InChI:InChI=1S/C22H32N2O4/c1-5-27-19(25)18-14-23(13-17-9-7-6-8-10-17)15-22(18)11-12-24(16-22)20(26)28-21(2,3)4/h6-10,18H,5,11-16H2,1-4H3
InChI key:InChIKey=YSMJRXHRUBYVTJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C2(CN(C(OC(C)(C)C)=O)CC2)CN(CC3=CC=CC=C3)C1
Synonyms:
  • 2-(1,1-Dimethylethyl) 9-ethyl 7-(phenylmethyl)-2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate
  • 2-(tert-Butyl) 9-ethyl 7-benzyl-2,7-diazaspiro[4.4]nonane-2,9-dicarboxylate
  • 2,7-Diazaspiro[4.4]nonane-2,9-dicarboxylic acid, 7-(phenylmethyl)-, 2-(1,1-dimethylethyl) 9-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.